
Catalog Number	AR00EEKV
Chemical Name	METHYL 2-OXO-2,3-DIHYDRO-1,3-BENZOXAZOLE-5-CARBOXYLATE
CAS Number	65422-70-0
Molecular Formula	C9H7NO4
Molecular Weight	193.1562
MDL Number	MFCD03572062
SMILES	COC(=O)c1ccc2c(c1)[nH]c(=O)o2

Methyl 2-oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylate is a versatile compound widely utilized in chemical synthesis for its key role as a building block in the creation of diverse organic molecules. With its unique structure and functional groups, this compound serves as a crucial intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its presence enables the efficient construction of complex molecular structures through important reactions such as esterification, amidation, and cyclization. Additionally, Methyl 2-oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylate plays an essential role in the development of novel materials and catalysts, highlighting its significance in the field of organic chemistry.