
Catalog Number	AR01DFEP
Chemical Name	Decanoyl/Octanoyl-Glycerides
CAS Number	65381-09-1
Molecular Formula	C24H48O8
Molecular Weight	464.6331
MDL Number	MFCD09752848
SMILES	CCCCCCCC(=O)OCC(CO)O.CCCCCCCCCC(=O)OCC(CO)O

Glycerol Tricaprylate, also known as caprylic/capric triglyceride, is a versatile compound widely used in chemical synthesis processes. This compound acts as an effective solvent, emollient, and carrier in various applications. In chemical synthesis, Glycerol Tricaprylate is utilized as a non-polar solubilizer for both hydrophobic and hydrophilic compounds. Its excellent solubilizing properties make it an ideal ingredient in formulations for emulsions, creams, and lotions. Moreover, Glycerol Tricaprylate is valued for its ability to enhance the stability and dispersion of active ingredients in formulations, contributing to the overall efficacy of the synthesized products. Its compatibility with a wide range of cosmetic and pharmaceutical ingredients makes Glycerol Tricaprylate a valuable component in the synthesis of various chemical formulations.