
Catalog Number	AR00EL8S
Chemical Name	C90140
CAS Number	65092-53-7
Molecular Formula	C9H5ClN2O2
Molecular Weight	208.6012
MDL Number	MFCD00024135
SMILES	[O-][N+](=O)c1cnc(c2c1cccc2)Cl

1-Chloro-4-nitroisoquinoline is a versatile building block in chemical synthesis due to its unique structural and chemical properties. This compound serves as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and materials.In organic synthesis, 1-Chloro-4-nitroisoquinoline is frequently used as a precursor for the introduction of diverse functional groups such as amines, halides, and nitro groups. The chloro group in the molecule can undergo substitution reactions with nucleophiles to yield a wide range of derivatives with tailored properties.Additionally, the nitro group in 1-Chloro-4-nitroisoquinoline can participate in various redox reactions, allowing for the synthesis of complex nitrogen-containing heterocycles. These heterocyclic compounds have proven valuable in medicinal chemistry for the development of novel drugs targeting a variety of diseases.Overall, the strategic incorporation of 1-Chloro-4-nitroisoquinoline in chemical synthesis provides chemists with a powerful tool to access diverse molecular architectures with potential applications in drug discovery, organic materials, and other related fields.