
Catalog Number	AR00ED20
Chemical Name	Unii-U2Y5ofn795
CAS Number	649735-63-7
Molecular Formula	C22H24FN5O4
Molecular Weight	441.4555
MDL Number	MFCD22577162
SMILES	C[C@@H](OC(=O)[C@@H](N)C)COc1cn2c(c1C)c(ncn2)Oc1ccc2c(c1F)cc([nH]2)C

Brivanib alaninate, also known as BMS-582664, is a promising compound used in chemical synthesis for its unique properties and versatile applications. As a potent and selective inhibitor of vascular endothelial growth factor receptor-2 (VEGFR-2) and fibroblast growth factor receptor (FGFR), Brivanib alaninate plays a crucial role in modulating angiogenesis and cell proliferation pathways.In the field of organic synthesis, Brivanib alaninate is utilized as a key intermediate in the preparation of various pharmaceutical compounds. Its strategic incorporation into synthetic routes enables the controlled manipulation of target molecules, leading to the creation of novel drug candidates with enhanced efficacy and reduced toxicity.Moreover, Brivanib alaninate's ability to selectively target specific receptors makes it a valuable tool in the development of targeted therapies for various diseases, including cancer and inflammatory disorders. By harnessing its inhibitory properties, researchers can design tailored treatment strategies that precisely interfere with aberrant signaling pathways responsible for pathological conditions.Overall, Brivanib alaninate stands out as a valuable asset in chemical synthesis, offering researchers a powerful and versatile building block to drive innovation in drug discovery and therapeutic development.