
Catalog Number	AR00EUFR
Chemical Name	ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate
CAS Number	649557-55-1
Molecular Formula	C13H11NO4
Molecular Weight	245.2307
MDL Number	MFCD03411527
SMILES	CCOC(=O)C(=O)CC(=O)c1ccc(cc1)C#N

Ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate is a versatile compound commonly utilized in chemical synthesis for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. This compound serves as a crucial building block in organic synthesis, enabling the construction of complex molecular structures with diverse functionalities.In chemical synthesis, Ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate is often employed as a key intermediate in the production of medicinally important compounds such as non-steroidal anti-inflammatory drugs, antifungal agents, and other bioactive molecules. Its structural attributes make it a valuable precursor for the synthesis of heterocyclic compounds and biologically active derivatives.Furthermore, this compound exhibits excellent reactivity towards a wide range of chemical transformations, including condensation reactions, cyclizations, and functional group modifications. Its versatile nature and chemical stability make it a sought-after compound for designing and developing novel organic molecules with enhanced biological activities and pharmacological properties.Overall, the application of Ethyl 4-(4-cyanophenyl)-2,4-dioxobutanoate in chemical synthesis plays a crucial role in the creation of advanced materials and pharmaceutical compounds, contributing significantly to the advancement of modern organic chemistry and drug discovery efforts.