
Catalog Number	AR00EFQ3
Chemical Name	3ALPHA-HYDROXY-5BETA-CHOLAN-24-OIC ACID N-[2-SULFOETHYL]AMIDE 3-SULFATE DISODIUM SALT
CAS Number	64936-83-0
Molecular Formula	C26H43NNa2O8S2
Molecular Weight	607.7311
MDL Number	MFCD00055891
SMILES	O=C(CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@H](C2)OS(=O)(=O)[O-])C)NCCS(=O)(=O)[O-].[Na+].[Na+]

Taurolithocholic Acid Sulfate Disodium Salt is a versatile compound that finds wide applications in chemical synthesis procedures. As a key ingredient in various synthetic reactions, this compound serves as an effective catalyst, promoting the formation of complex molecules through its unique chemical properties.One of the primary uses of Taurolithocholic Acid Sulfate Disodium Salt in chemical synthesis is as a reagent in the synthesis of novel pharmaceutical compounds. Its ability to facilitate intricate chemical transformations makes it an essential component in the creation of new drug candidates with potential therapeutic benefits.Furthermore, Taurolithocholic Acid Sulfate Disodium Salt is employed in the field of organic chemistry for the preparation of advanced intermediates and fine chemicals. Its compatibility with a wide range of substrates allows for the efficient synthesis of custom-designed molecules, enabling researchers to explore novel pathways in chemical synthesis.In addition, Taurolithocholic Acid Sulfate Disodium Salt serves as a valuable tool in the study of biochemical mechanisms and enzyme reactions. Its influence on various biochemical processes opens up avenues for understanding complex pathways and designing experiments to uncover new insights in the field of biochemistry.Overall, Taurolithocholic Acid Sulfate Disodium Salt is a crucial component in chemical synthesis, offering researchers and chemists a powerful tool to advance their scientific explorations and innovate in the realm of chemical discovery and development.