
Catalog Number	AR00ECD5
Chemical Name	5,6-Dichloro-2-Methylbenzimidazole
CAS Number	6478-79-1
Molecular Formula	C8H6Cl2N2
Molecular Weight	201.05264
MDL Number	MFCD00276973
SMILES	Cc1[nH]c2c(n1)cc(c(c2)Cl)Cl

In chemical synthesis, 5,6-Dichloro-2-methyl-1H-benzo[d]imidazole serves as a valuable reagent for various reactions due to its unique structural properties. This compound is commonly used as a versatile building block in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Its chlorine-substituted benzimidazole scaffold provides an ideal platform for introducing specific functional groups through further chemical modifications. Additionally, the presence of a methyl group at the 2-position offers opportunities for stereochemical control and selective derivatization in synthetic pathways. The reactivity and stability of 5,6-Dichloro-2-methyl-1H-benzo[d]imidazole make it a promising intermediate in the production of complex organic molecules with diverse applications in the chemical industry.