
Catalog Number	AR00EDF7
Chemical Name	6H-Benzofuro[3,2-c][1]benzopyran-6-one, 1,3,8,9-tetrahydroxy-
CAS Number	6468-55-9
Molecular Formula	C15H8O7
Molecular Weight	300.21981999999997
MDL Number	MFCD09264645
SMILES	Oc1cc(O)c2c(c1)oc(=O)c1c2oc2c1cc(c(c2)O)O

The compound $name$ is commonly utilized in chemical synthesis as a versatile building block due to its unique structure and properties. With its 6H-benzofuro[3,2-c][1]benzopyran-6-one backbone and four hydroxyl groups at positions 1, 3, 8, and 9, this compound serves as a valuable intermediate in the production of various complex molecules. Its hydroxyl groups can participate in a range of chemical reactions such as esterification, etherification, and dehydration, allowing for the facile modification of the compound to tailor its reactivity and properties for specific synthetic pathways. Additionally, the rigid and planar structure of the benzofurobenzopyran scaffold provides stability and rigidity to the molecular framework, making it suitable for constructing intricate molecular architectures. Its ability to undergo different transformations makes $name$ a valuable tool in the synthesis of pharmaceuticals, natural products, and advanced materials.