
Catalog Number	AR00EKEL
Chemical Name	Etoricoxib Impurity 12
CAS Number	646459-41-8
Molecular Formula	C21H16ClN3O2S
Molecular Weight	409.88863999999995
MDL Number	MFCD31536316
SMILES	Clc1cnc2c(c1)cc(c(n2)c1ccc(nc1)C)c1ccc(cc1)S(=O)(=O)C

6-Chloro-2-(6-methylpyridin-3-yl)-3-(4-(methylsulfonyl)phenyl)-1,8-naphthyridine, also known as $name$, is a versatile compound that is widely used in chemical synthesis. It serves as a valuable building block in the creation of various organic molecules due to its unique structural properties and reactivity.In chemical synthesis, 6-Chloro-2-(6-methylpyridin-3-yl)-3-(4-(methylsulfonyl)phenyl)-1,8-naphthyridine can act as a key intermediate for the construction of complex organic compounds with specific functionalities. Its chloro, methyl, and sulfonyl substituents provide different points of attachment for further modification, allowing chemists to tailor the molecule for desired properties and applications.By incorporating 6-Chloro-2-(6-methylpyridin-3-yl)-3-(4-(methylsulfonyl)phenyl)-1,8-naphthyridine into synthetic pathways, chemists can access a wide range of structurally diverse compounds with potential applications in pharmaceuticals, agrochemicals, materials science, and other fields. Its strategic placement in a synthesis scheme can enable the efficient and selective formation of new bonds, leading to the creation of novel molecules with enhanced properties and functionalities.