
Catalog Number	AR00EDT1
Chemical Name	N-BOC-4-(P-FLUOROPHENYL)-4-PIPERIDINECARBOXYLIC ACID
CAS Number	644981-89-5
Molecular Formula	C17H22FNO4
Molecular Weight	323.3593
MDL Number	MFCD05861568
SMILES	OC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)c1ccc(cc1)F

1-(tert-Butoxycarbonyl)-4-(4-fluorophenyl)piperidine-4-carboxylic acid, commonly referred to as $name$, is a versatile compound widely used in chemical synthesis applications. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals.One important application of $name$ is its utilization as a precursor in the synthesis of novel piperidine-based compounds. By selectively modifying the functional groups on the piperidine ring and the carboxylic acid moiety, chemists can access a diverse range of structurally complex molecules with potentially valuable biological activities.Furthermore, the tert-butoxycarbonyl (Boc) protective group present in $name$ plays a crucial role in controlling the reactivity and selectivity of chemical reactions during the synthesis process. The Boc group can be selectively removed under mild conditions, allowing for further functionalization of the molecule without affecting other sensitive parts of the structure.In summary, the strategic incorporation of 1-(tert-Butoxycarbonyl)-4-(4-fluorophenyl)piperidine-4-carboxylic acid in chemical synthesis enables chemists to access new chemical entities with diverse pharmacological properties and potential applications in drug discovery and development.