
Catalog Number	AR00ELVA
Chemical Name	tert-butyl 3-(trifluoromethyl)pyrrolidine-1-carboxylate
CAS Number	644970-40-1
Molecular Formula	C10H16F3NO2
Molecular Weight	239.2347
MDL Number	MFCD11501672
SMILES	O=C(N1CCC(C1)C(F)(F)F)OC(C)(C)C

1,1-Dimethylethyl 3-(trifluoromethyl)-1-pyrrolidinecarboxylate is a versatile compound widely utilized in chemical synthesis, particularly in the realm of organic chemistry. Its unique structure and properties make it an excellent building block for the creation of complex molecules and pharmaceutical intermediates. This compound is frequently employed as a key reagent in the formation of various heterocyclic compounds, which are essential in the development of new drugs, agrochemicals, and materials. Additionally, its trifluoromethyl and pyrrolidine functionalities confer distinct chemical reactivity, allowing for selective transformations and enhancing the efficiency of synthetic processes. Researchers and chemists rely on 1,1-Dimethylethyl 3-(trifluoromethyl)-1-pyrrolidinecarboxylate to facilitate the synthesis of valuable compounds with enhanced biological activities and unique properties.