
Catalog Number	AR00EEAI
Chemical Name	Homo Sildenafil
CAS Number	642928-07-2
Molecular Formula	C23H32N6O4S
Molecular Weight	488.603
MDL Number	MFCD09752148
SMILES	CCOc1ccc(cc1c1[nH]c(=O)c2c(n1)c(CCC)nn2C)S(=O)(=O)N1CCN(CC1)CC

Homosildenafil is a potent chemical compound that serves a crucial role in chemical synthesis. As a structural analog of sildenafil, it exhibits similar pharmacological properties and has found significant application in the development of pharmaceutical intermediates. In the realm of chemical synthesis, Homosildenafil is utilized as a key building block in the production of various drugs and specialized compounds. Its unique molecular structure and reactivity make it a valuable tool for organic chemists seeking to create novel molecules with specific biological activities. By incorporating Homosildenafil into synthetic pathways, chemists can efficiently access a diverse array of molecular frameworks, allowing for the creation of new drug candidates and innovative materials. This versatile compound plays a vital role in advancing the field of chemical synthesis and holds promise for the development of cutting-edge pharmaceuticals and materials.