
Catalog Number	AR00EJVU
Chemical Name	1-[(4-NITROPHENYL)SULFONYL]PIPERIDINE
CAS Number	64268-93-5
Molecular Formula	C11H14N2O4S
Molecular Weight	270.3049
MDL Number	MFCD00276970
SMILES	O=S(=O)(c1ccc(cc1)[N+](=O)[O-])N1CCCCC1

1-((4-Nitrophenyl)sulfonyl)piperidine, a versatile compound in chemical synthesis, serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure and reactivity make it a valuable intermediate for synthesizing complex molecules with specific biological activities. By incorporating 1-((4-Nitrophenyl)sulfonyl)piperidine into synthetic routes, chemists can introduce functional groups, modify molecular properties, and enhance the overall efficiency of chemical reactions. Overall, this compound plays a crucial role in expanding the scope of organic synthesis and driving innovation in the development of new compounds with diverse applications.