
Catalog Number	AR00EDEC
Chemical Name	4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid ethyl ester
CAS Number	641569-97-3
Molecular Formula	C19H18N4O2
Molecular Weight	334.37182000000007
MDL Number	MFCD11100712
SMILES	CCOC(=O)c1ccc(c(c1)Nc1nccc(n1)c1cccnc1)C

The Ethyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate compound is a versatile building block in chemical synthesis. Its unique structure and properties make it a valuable component in the development of novel pharmaceuticals and agrochemicals. In chemical synthesis, Ethyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate can be used as a key intermediate in the creation of bioactive molecules. Its strategic placement of functional groups allows for the synthesis of complex structures with specific biological activities. Furthermore, this compound can serve as a precursor for the modification of drug candidates, enabling the fine-tuning of pharmacokinetic and pharmacodynamic properties. Its inclusion in synthetic pathways can lead to the development of potent compounds with enhanced efficacy and reduced side effects.Overall, the application of Ethyl 4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)benzoate in chemical synthesis opens up opportunities for the creation of cutting-edge therapeutics and crop protection agents, showcasing its importance in the field of medicinal and agricultural chemistry.