
Catalog Number	AR00EMLS
Chemical Name	Ethyl 6-chloro-5-cyano-2-methylnicotinate
CAS Number	64119-42-2
Molecular Formula	C10H9ClN2O2
Molecular Weight	224.6437
MDL Number	MFCD00179894
SMILES	Cc1nc(Cl)c(cc1C(=O)OCC)C#N

Ethyl 6-chloro-5-cyano-2-methylnicotinate is a versatile compound widely used in chemical synthesis for the preparation of various organic molecules. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals due to its unique structural properties. In the field of medicinal chemistry, it is employed as a building block for the synthesis of potential drug candidates with biological activities.Additionally, Ethyl 6-chloro-5-cyano-2-methylnicotinate plays a crucial role in the development of new materials such as polymers, dyes, and catalysts. Its specific functional groups enable the modification of its chemical structure through diverse synthetic methods, allowing researchers to tailor its properties for specific applications. Moreover, this compound can be utilized in the preparation of novel heterocyclic compounds with potential applications in various industries.Overall, Ethyl 6-chloro-5-cyano-2-methylnicotinate is a valuable compound in chemical synthesis, offering a wide range of possibilities for the creation of innovative molecules with diverse functionalities and applications.