
Catalog Number	AR00ECLG
Chemical Name	11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE
CAS Number	641-77-0
Molecular Formula	C12H10Br2Cl2N4O8S
Molecular Weight	601.0088
MDL Number	MFCD00056476
SMILES	[O-]S(=O)(=O)[O-].[NH3+]c1c(Cl)cc(cc1Br)[N+](=O)[O-].[NH3+]c1c(Cl)cc(cc1Br)[N+](=O)[O-]

(8S,9S,10R,11S,13S,14S,17R)-17-Acetyl-11,17-dihydroxy-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one, also known as $name$, is a valuable compound in chemical synthesis due to its versatile applications. It serves as a key intermediate in the production of various pharmaceuticals, steroids, and related organic compounds. With its unique structural features, $name$ can be used as a building block for synthesizing complex molecules with specific stereochemical configurations. Its acetyl and hydroxyl groups allow for selective functionalization reactions, making it a valuable tool in organic synthesis strategies. Additionally, the presence of multiple chiral centers in $name$ provides opportunities for stereocontrolled transformations, enabling chemists to access a wide range of enantiomerically pure compounds.