
Catalog Number	AR003W42
Chemical Name	Sodium 5-(4-chlorobenzoyl)-1,4-dimethyl-1H-pyrrole-2-acetate
CAS Number	64092-48-4
Molecular Formula	C15H13ClNNaO3
Molecular Weight	313.71139000000005
MDL Number	MFCD00057223
SMILES	[O-]C(=O)Cc1cc(c(n1C)C(=O)c1ccc(cc1)Cl)C.[Na+]

Zomepirac sodium is a potent nonsteroidal anti-inflammatory drug (NSAID) that has found significant applications in chemical synthesis, particularly in the pharmaceutical industry. In the realm of organic chemistry, Zomepirac sodium serves as a valuable building block for the creation of more complex molecules through a variety of synthetic routes. Its unique structure and reactivity make it a versatile tool for the creation of novel drug candidates and therapeutic agents. Researchers utilize Zomepirac sodium in the development of new pharmaceuticals due to its ability to undergo various reactions and functional group transformations, enabling the construction of diverse chemical frameworks. The precise control over its chemical properties allows for the synthesis of tailored compounds with specific biological activities, making it a key component in the quest for innovative drug discovery.