
Catalog Number	AR00E9FM
Chemical Name	Sodium Dehydroacetate Monohydrate
CAS Number	64039-28-7
Molecular Formula	C8H9NaO5
Molecular Weight	208.1438
MDL Number	MFCD01694098
SMILES	Cc1cc(=O)[c-](c(=O)o1)C(=O)C.[Na+].O

Sodium Dehydroacetate Monohydrate is a versatile compound commonly utilized in chemical synthesis processes. This compound acts as an effective preservative in various formulations due to its antimicrobial properties. In chemical synthesis, Sodium Dehydroacetate Monohydrate is widely employed as a key component in the production of pharmaceuticals, cosmetics, and personal care products. Its ability to inhibit the growth of harmful microorganisms makes it an essential ingredient in the manufacturing of a wide range of goods. Additionally, this compound plays a crucial role in extending the shelf life of products by preventing microbial contamination, ensuring quality and safety for consumers.