
Catalog Number	AR00EBSR
Chemical Name	ESERINE SULFATE
CAS Number	64-47-1
Molecular Formula	C30H44N6O8S
Molecular Weight	648.7708
MDL Number	MFCD06795853
SMILES	OS(=O)(=O)O.CNC(=O)Oc1ccc2c(c1)[C@]1(C)CCN([C@@H]1N2C)C.CNC(=O)Oc1ccc2c(c1)[C@]1(C)CCN([C@@H]1N2C)C

Pyrrolo[2,3-b]indol-5-ol, 1,2,3,3a,8,8a-hexahydro-1,3a,8-trimethyl-, 5-(N-methylcarbamate), (3aS,8aR)-, sulfate (2:1) is a versatile compound widely utilized in chemical synthesis. Its unique structure and reactivity make it a valuable building block in the creation of novel organic molecules. In chemical synthesis, this compound serves as a crucial intermediate for the preparation of various biologically active compounds and pharmaceuticals. Its functional groups allow for the introduction of additional substituents, enabling the synthesis of complex heterocyclic compounds with diverse applications. Furthermore, the sulfate salt form of this compound enhances its solubility and compatibility in aqueous environments, making it suitable for reactions that require a polar medium. Its stability and selective reactivity make it a preferred reagent in the synthesis of organic compounds with potential pharmaceutical or agrochemical properties.