
Catalog Number	AR00EHFU
Chemical Name	Z-GLU-NH2
CAS Number	6398-06-7
Molecular Formula	C13H16N2O5
Molecular Weight	280.2765
MDL Number	MFCD00238433
SMILES	O=C(N[C@H](C(=O)N)CCC(=O)O)OCc1ccccc1

The compound (4S)-5-Amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid is a versatile chemical reagent commonly used in chemical synthesis. Its primary application lies in its ability to act as a key building block for the creation of peptide compounds. By serving as a protected form of amino acids, this compound plays a crucial role in peptide synthesis by offering a means to selectively introduce amino acid residues into peptide chains while maintaining their integrity and reactivity. Additionally, (4S)-5-Amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid can be utilized in the creation of peptide mimetics and other bioactive molecules, making it a valuable tool in the realm of medicinal chemistry and drug development. Its selective reactivity and compatibility with various coupling agents make it an essential component in the synthesis of complex peptides and peptide-based compounds with specific biological activities.