
Catalog Number	AR00EEVE
Chemical Name	3-AMINO-5,7-DIMETHYLADAMANTAN-1-OL Hydrochloride
CAS Number	63971-25-5
Molecular Formula	C12H21NO
Molecular Weight	195.3012
MDL Number	MFCD01838635
SMILES	CC12CC3(C)CC(C1)(N)CC(C2)(C3)O

3-Amino-5,7-dimethyladamantan-1-ol, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis processes. This compound plays a crucial role in the production of pharmaceutical intermediates due to its unique structure and functional groups.In chemical synthesis, $name$ is often employed as a key building block in the creation of complex molecules. Its specific arrangement of atoms makes it a valuable starting material for the synthesis of various pharmaceutical compounds, such as antiviral agents and potential drug candidates. The presence of the amino group and the adamantane backbone in $name$ allows for strategic functionalization and modification, leading to the formation of diverse chemical structures with specific properties.Furthermore, the presence of methyl groups in the structure of $name$ enhances its stability and reactivity in chemical reactions. This characteristic makes it a favorable choice for organic chemists seeking to introduce specific functionalities or stereochemistry into their target molecules during the synthesis process.Overall, the application of 3-Amino-5,7-dimethyladamantan-1-ol in chemical synthesis holds great promise for the development of novel pharmaceuticals and chemical products, serving as a valuable building block for innovative research in the field of organic chemistry.