
Catalog Number	AR01C149
Chemical Name	2-(Difluoromethyl)-1-fluoro-4-nitrobenzene
CAS Number	63878-71-7
Molecular Formula	C7H4F3NO2
Molecular Weight	191.1074
MDL Number	MFCD14698657
SMILES	FC(c1cc(ccc1F)[N+](=O)[O-])F

The compound 2-(Difluoromethyl)-1-fluoro-4-nitrobenzene has shown great potential in chemical synthesis as a versatile building block. Its unique combination of difluoromethyl, fluoro, and nitro functional groups makes it a valuable intermediate for the synthesis of various organic compounds. Its presence in a molecule can significantly influence its reactivity and physicochemical properties.In organic synthesis, 2-(Difluoromethyl)-1-fluoro-4-nitrobenzene can be utilized for the introduction of difluoromethyl and nitro groups into different organic frameworks. These functional groups are commonly found in many biologically active compounds and pharmaceuticals, making this compound a valuable tool in drug discovery research.Additionally, the presence of a fluoro group in 2-(Difluoromethyl)-1-fluoro-4-nitrobenzene can serve as a handle for further derivatization via transition metal-catalyzed cross-coupling reactions or nucleophilic fluorination reactions. This allows for the incorporation of additional functional groups or structural modifications, enabling the synthesis of complex molecules with tailored properties.Overall, 2-(Difluoromethyl)-1-fluoro-4-nitrobenzene is a promising building block in chemical synthesis, offering a wide range of possibilities for the construction of novel compounds with potential applications in various fields, including medicinal chemistry, materials science, and agrochemicals.