
Catalog Number	AR00F6VC
Chemical Name	N-[[2-Chloro-3-[(phenylamino)methylene]-1-cyclopenten-1-yl]methylene]-benzenamine monohydrochloride
CAS Number	63856-99-5
Molecular Formula	C19H18Cl2N2
Molecular Weight	345.26561999999996
SMILES	ClC1=C(C=Nc2ccccc2)CCC1=CNc1ccccc1.Cl

Benzenamine, N-[[2-chloro-3-[(phenylamino)methylene]-1-cyclopenten-1-yl]methylene]-, hydrochloride (1:1) is a versatile compound widely utilized in chemical synthesis applications. Due to its unique molecular structure, this compound serves as a valuable intermediate in the synthesis of various pharmaceuticals, agrochemicals, and organic compounds. Its chemical properties make it a key reagent in the creation of complex molecules and functional materials, allowing for the development of cutting-edge products in the fields of medicine, agriculture, and materials science. With its strategic role in chemical synthesis, this compound enables the efficient production of innovative compounds with diverse applications and potential benefits across industries.