
Catalog Number	AR00EZLU
Chemical Name	Hygromycin A
CAS Number	6379-56-2
Molecular Formula	C23H29NO12
Molecular Weight	511.47586
MDL Number	MFCD00242795
SMILES	CC(=O)[C@H]1O[C@H]([C@H]([C@@H]1O)O)Oc1ccc(cc1O)C=C(C(=O)N[C@@H]1[C@H](O)[C@@H](O)[C@@H]2[C@H]([C@@H]1O)OCO2)C

Hygromycin is a potent antibiotic commonly utilized in chemical synthesis processes for its notable ability to inhibit protein synthesis in both prokaryotic and eukaryotic cells. Due to its selective action on cells possessing a neo gene, Hygromycin is particularly effective in genetic transformation experiments where it is employed as a selective agent to determine the success of gene transfer. In chemical synthesis, Hygromycin plays a critical role in various applications such as the production of recombinant proteins, gene knockdown experiments, and the creation of transgenic organisms. Its broad spectrum of activity and high efficacy make Hygromycin a valuable tool in advancing research and development efforts across diverse scientific fields, including molecular biology, biotechnology, and pharmaceuticals.