
Catalog Number	AR00EAD3
Chemical Name	CHARTREUSIN
CAS Number	6377-18-0
Molecular Formula	C32H32O14
Molecular Weight	640.5881
SMILES	COC1C(O)C(OC2C(OC(C(C2O)O)C)Oc2cccc3c2c2oc(=O)c4c5c2c(c3O)c(=O)oc5ccc4C)OC(C1O)C

Chartreusin is a potent natural product with distinctive properties that make it a valuable tool in chemical synthesis. Its ability to selectively bind to DNA and induce strand scission has been harnessed in various synthetic applications, particularly in the field of medicinal chemistry. By exploiting Chartreusin's unique DNA-binding properties, chemists can design and develop novel compounds that target specific genetic sequences, offering promising opportunities for the treatment of cancer and other diseases. The application of Chartreusin in chemical synthesis therefore represents a powerful strategy for creating innovative therapeutics with enhanced precision and efficacy.