
Catalog Number	AR00EKJ3
Chemical Name	tert-Butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate
CAS Number	637362-21-1
Molecular Formula	C17H23ClN2O2
Molecular Weight	322.8297
MDL Number	MFCD12198568
SMILES	Clc1ccc2c(c1)C1(CCN(CC1)C(=O)OC(C)(C)C)CN2

The tert-Butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate compound plays a crucial role in chemical synthesis, particularly in the development of novel pharmaceuticals and agrochemicals. This specialized compound serves as a versatile building block in the creation of complex organic molecules with diverse functionalities. By incorporating tert-Butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate into synthetic pathways, chemists can access unique structural motifs and stereochemical arrangements that are essential for the discovery and optimization of bioactive compounds. This compound's ability to facilitate the formation of spirocyclic systems makes it a valuable tool for medicinal chemists and researchers seeking to design molecules with enhanced biological activities and pharmacological properties. With its strategic positioning and reactivity in chemical reactions, tert-Butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate enables the efficient construction of intricate molecular architectures, driving innovation and advancement in the field of organic synthesis.