
Catalog Number	AR01CBHQ
Chemical Name	N~1~-(2,4-dinitrophenyl)benzene-1,4-diamine
CAS Number	6373-73-5
Molecular Formula	C12H10N4O4
Molecular Weight	274.2322
MDL Number	MFCD00007851
SMILES	Nc1ccc(cc1)Nc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-]
NSC Number	60560

Disperse Yellow 9, a vibrant and versatile dye compound, plays a crucial role in chemical synthesis processes. This compound holds significance as an essential component in various industries, particularly in the field of textile dyeing. Its exceptional solubility in organic solvents enables it to be effectively dispersed in a wide range of substrates, allowing for the creation of vivid yellow hues with excellent color fastness. In addition to its application in textile industries, Disperse Yellow 9 is also utilized in research laboratories for staining and visualization purposes due to its distinctive color properties. Furthermore, its compatibility with a variety of synthetic materials makes it a valuable tool in the development of new products and materials. Its ability to undergo chemical reactions and form stable complexes further enhances its utility in organic synthesis, making Disperse Yellow 9 an indispensable compound in the realm of chemical innovation.