
Catalog Number	AR00ECDC
Chemical Name	Methyl 2-(chloromethyl)-1H-benzo[d]imidazole-7-carboxylate
CAS Number	636574-35-1
Molecular Formula	C10H9ClN2O2
Molecular Weight	224.6437
MDL Number	MFCD17214274
SMILES	COC(=O)c1cccc2c1[nH]c(n2)CCl

Methyl 2-(chloromethyl)-1H-benzo[d]imidazole-7-carboxylate is a versatile compound widely utilized in chemical synthesis processes. Its unique structure allows for the efficient introduction of the chloromethyl group to various molecules, making it an essential reagent in the creation of complex organic compounds. This compound is particularly valuable in the development of pharmaceuticals, agrochemicals, and materials science due to its ability to serve as a key building block in the synthesis of diverse molecular structures. Additionally, Methyl 2-(chloromethyl)-1H-benzo[d]imidazole-7-carboxylate is employed in the preparation of novel heterocyclic compounds with potential pharmacological activities, highlighting its significance in the field of medicinal chemistry.