
Catalog Number	AR00EI3E
Chemical Name	9,10-DIOXO-9,10-DIHYDROANTHRACENE-2-CARBALDEHYDE
CAS Number	6363-86-6
Molecular Formula	C15H8O3
Molecular Weight	236.2222
MDL Number	MFCD00795515
SMILES	O=Cc1ccc2c(c1)C(=O)c1c(C2=O)cccc1

9,10-Dioxo-9,10-dihydro-anthracene-2-carbaldehyde is a versatile compound utilized in various chemical synthesis processes. It serves as a key intermediate in the production of organic compounds with complex structures and functionalities. This compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique chemical properties enable it to participate in a wide range of reactions, including condensation, oxidation, and cyclization reactions. Additionally, 9,10-Dioxo-9,10-dihydro-anthracene-2-carbaldehyde is commonly employed as a building block for the creation of advanced materials and dyes. Its significance in chemical synthesis lies in its ability to facilitate the formation of intricate molecular structures, making it an indispensable tool for organic chemists and researchers seeking to develop novel compounds with diverse applications.