
Catalog Number	AR00EB2F
Chemical Name	(R)-(-)-2-Methoxy-2-(1-naphthyl)propionic Acid
CAS Number	63628-26-2
Molecular Formula	C14H14O3
Molecular Weight	230.2592
MDL Number	MFCD03093633
SMILES	CO[C@](c1cccc2c1cccc2)(C(=O)O)C

The compound (R)-2-Methoxy-2-(naphthalen-1-yl)propanoic acid, also known as $name$, is a versatile building block used in chemical synthesis. Its unique molecular structure, containing both a methoxy group and a naphthalene moiety, allows it to participate in various reactions to generate complex organic molecules. One of the key applications of this compound is as a chiral starting material in the synthesis of pharmaceutical intermediates and fine chemicals. By leveraging its chiral nature, chemists can access enantiomerically pure compounds with high stereochemical control, crucial for drug development and materials science. In addition, $name$ serves as a valuable tool in the preparation of novel materials for advanced materials research and drug discovery efforts. Its role in chemical synthesis extends to the creation of functionalized molecules with tailored properties, making it an indispensable component in modern organic chemistry endeavors.