
Catalog Number	AR00E9BN
Chemical Name	Diethyl isophthalate
CAS Number	636-53-3
Molecular Formula	C12H14O4
Molecular Weight	222.2372
MDL Number	MFCD01717556
SMILES	CCOC(=O)c1cccc(c1)C(=O)OCC
NSC Number	249815

Diethyl isophthalate is a versatile compound widely used in chemical synthesis due to its diverse applications. One of its key uses is as a building block in the production of various polymers and resins. It is commonly employed as a monomer in the synthesis of polyesters, polyamides, and polyurethanes, where it contributes to the material's properties such as flexibility, durability, and thermal stability. Additionally, Diethyl isophthalate is utilized as a plasticizer in the manufacturing of plastics, imparting flexibility and enhancing the overall performance of the final product. Its chemical reactivity and compatibility with a wide range of other compounds make it a valuable ingredient in the synthesis of specialty chemicals and pharmaceutical intermediates. Overall, Diethyl isophthalate plays a crucial role in the development of advanced materials and chemical products.