
Catalog Number	AR019DJH
Chemical Name	1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(tetrahydro-2-furoyl)piperazine
CAS Number	63590-64-7
Molecular Formula	C19H25N5O4
Molecular Weight	387.4329
MDL Number	MFCD00072144
SMILES	COc1cc2nc(nc(c2cc1OC)N)N1CCN(CC1)C(=O)C1CCCO1

Terazosin, a selective alpha-1 adrenergic receptor antagonist, plays a crucial role in chemical synthesis as a key building block for the preparation of various pharmaceutical compounds. Its application in organic chemistry involves its use as a chiral auxiliary, enabling the enantioselective synthesis of complex molecules. By leveraging the unique stereochemistry of Terazosin, chemists can control the chirality of final products, opening up avenues for the production of enantiomerically pure drugs and other biologically active molecules. Additionally, Terazosin serves as a versatile starting material in the synthesis of heterocyclic compounds, providing a foundation for the creation of diverse chemical structures with potential therapeutic applications. Its utility in chemical synthesis underscores its significance as a valuable tool for advancing the development of novel pharmaceuticals and functional materials.