
Catalog Number	AR00EBQM
Chemical Name	4-(4-BUTOXYPHENYL)-4-OXOBUTANOIC ACID
CAS Number	63471-88-5
Molecular Formula	C14H18O4
Molecular Weight	250.2903
MDL Number	MFCD00100663
SMILES	CCCCOc1ccc(cc1)C(=O)CCC(=O)O

Benzenebutanoic acid, 4-butoxy-g-oxo- is a powerful chemical compound widely utilized in the field of chemical synthesis. This compound plays a crucial role in various reactions due to its versatile properties and the flexibility it offers in creating new compounds.In chemical synthesis, Benzenebutanoic acid, 4-butoxy-g-oxo- is commonly used as a building block for the creation of more complex molecules. Its structure allows for strategic modifications and additions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. By incorporating this compound into a reaction, chemists can control the formation of specific functional groups and stereochemistry, leading to the production of target compounds with high purity and efficiency.Furthermore, Benzenebutanoic acid, 4-butoxy-g-oxo- can act as a catalyst or a reagent in certain reactions, promoting the formation of desired products or facilitating key steps in a synthesis pathway. Its presence can enhance reaction rates, improve yields, and enable the synthesis of complex molecules that would otherwise be challenging to obtain.Overall, Benzenebutanoic acid, 4-butoxy-g-oxo- is a valuable tool in chemical synthesis, offering chemists the opportunity to explore new synthetic routes, optimize reaction conditions, and advance the development of innovative compounds with diverse applications.