
Catalog Number	AR00ED2L
Chemical Name	ethyl 2-oxo-2,3-dihydro-1H-benzo[d]iMidazole-5-carboxylate
CAS Number	634602-84-9
Molecular Formula	C10H10N2O3
Molecular Weight	206.1980
MDL Number	MFCD12912129
SMILES	CCOC(=O)c1ccc2c(c1)[nH]c(n2)O

Ethyl 2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate is a versatile compound widely used in chemical synthesis as a key building block in organic reactions. This compound serves as a valuable intermediate for the preparation of various biologically active molecules and pharmaceuticals. Its unique structure and reactivity make it an essential component in the synthesis of heterocyclic compounds, which are crucial in drug discovery and development. By utilizing Ethyl 2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate, chemists can efficiently access complex molecular frameworks with diverse functional groups, enabling the creation of novel compounds with potential therapeutic applications. Additionally, this compound plays a vital role in the synthesis of agrochemicals, dyes, and materials science, highlighting its significance in modern organic chemistry research.