
Catalog Number	AR003A3G
Chemical Name	3,8,15,20,27,32-Hexaoxatetracyclo[32.2.2.210,13.222,25]dotetraconta-1(36),10,12,22,24,34,37,39,41-nonaene-2,9,14,21,26,33-hexone
CAS Number	63440-94-8
Molecular Formula	C36H36O12
Molecular Weight	660.6638
MDL Number	MFCD22572531
SMILES	O=C1OCCCCOC(=O)c2ccc(cc2)C(=O)OCCCCOC(=O)c2ccc(C(=O)OCCCCOC(=O)c3ccc1cc3)cc2

Cyclotris(1,4-butylene terephthalate) is a versatile compound commonly used in chemical synthesis due to its unique structure and properties. As a cyclic oligomer consisting of three 1,4-butylene terephthalate units, this molecule serves as a building block for various polymerization reactions and material synthesis processes.In chemical synthesis, Cyclotris(1,4-butylene terephthalate) is often employed as a monomer in the preparation of polymers with desired properties. Its cyclic structure allows for controlled polymerization reactions, leading to the formation of polymers with specific sizes, shapes, and functionalities. Additionally, the presence of terephthalate units imparts thermal stability and chemical resistance to the resulting polymers, making them suitable for a wide range of applications.Due to its ability to undergo polymerization and crosslinking reactions, Cyclotris(1,4-butylene terephthalate) finds utility in the production of specialty materials such as adhesives, coatings, and resins. These materials exhibit enhanced mechanical strength, durability, and thermal performance, making them ideal for industries requiring high-performance materials.Furthermore, the unique structure of Cyclotris(1,4-butylene terephthalate) enables its use in the design and synthesis of novel macromolecules with tailored properties. By incorporating this cyclic oligomer into polymer networks, researchers can explore the potential for creating advanced materials with specific characteristics, such as biocompatibility, conductive properties, or stimuli-responsive behavior.In summary, Cyclotris(1,4-butylene terephthalate) plays a critical role in chemical synthesis by serving as a key building block for the creation of specialized polymers and materials with enhanced functionalities. Its versatility and unique structure make it a valuable component in the development of innovative solutions for various industrial applications.