
Catalog Number	AR00ELX9
Chemical Name	4-[(4-methylphenyl)sulphonyl]morpholine
CAS Number	6339-26-0
Molecular Formula	C11H15NO3S
Molecular Weight	241.3067
MDL Number	MFCD00196072
SMILES	Cc1ccc(cc1)S(=O)(=O)N1CCOCC1
NSC Number	12118

4-tosylmorpholine is a versatile chemical compound widely used in organic synthesis for its unique reactivity and functional group tolerance. This heterocyclic compound serves as a valuable building block in various chemical reactions, especially in the construction of complex molecules. Its application in chemical synthesis extends to the formation of pharmaceutical intermediates, agrochemicals, and materials science. Due to its stability and compatibility with a wide range of functional groups, 4-tosylmorpholine is employed in the synthesis of diverse organic compounds with high efficiency and selectivity. Its versatile nature makes it a valuable tool for chemists and researchers engaged in the development of novel molecules and compounds for various applications.