
Catalog Number	AR00IBVX
Chemical Name	D-Lysine, N6-[(1,1-dimethylethoxy)carbonyl]-, methyl ester
CAS Number	63328-49-4
Molecular Formula	C12H24N2O4
Molecular Weight	260.32995999999997
MDL Number	MFCD02094344
SMILES	COC(=O)[C@@H](CCCCNC(=O)OC(C)(C)C)N

D-Lysine, N6-[(1,1-dimethylethoxy)carbonyl]-, methyl ester is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block in organic chemistry, specifically in the creation of peptide and amino acid derivatives. Its unique structure and reactivity make it an essential component in the development of pharmaceuticals, agrochemicals, and materials science. By incorporating D-Lysine, N6-[(1,1-dimethylethoxy)carbonyl]-, methyl ester into synthetic pathways, researchers can access a diverse range of complex molecules with tailored properties and functions. Its application in chemical synthesis enables the efficient production of intricate organic compounds with precise stereochemistry and molecular architectures.