
Catalog Number	AR00EGKJ
Chemical Name	BENZYL-N-METHYL-L-ALANINE
CAS Number	63238-82-4
Molecular Formula	C11H15NO2
Molecular Weight	193.2423
MDL Number	MFCD01632093
SMILES	C[C@@H](C(=O)O)N(Cc1ccccc1)C

Benzyl-N-methyl-L-alanine is a valuable compound widely utilized in chemical synthesis for its diverse applications. This compound serves as a key building block in the production of pharmaceuticals, particularly in the creation of peptide-based drugs. Its unique chemical structure allows for modification and incorporation into peptide chains, enabling the development of novel therapeutic agents with enhanced properties.In chemical synthesis, Benzyl-N-methyl-L-alanine is commonly employed as a chiral auxiliary, facilitating asymmetric synthesis of complex molecules. Its chirality plays a crucial role in controlling the stereochemistry of reactions, leading to the production of enantiomerically pure compounds essential in drug development. Additionally, Benzyl-N-methyl-L-alanine serves as a precursor for the synthesis of various amino acid derivatives and peptidomimetics, expanding the scope of potential applications in medicinal chemistry.Overall, Benzyl-N-methyl-L-alanine's versatility and utility in chemical synthesis make it a valuable tool for researchers and chemists involved in drug discovery and development, offering opportunities for the creation of innovative pharmaceuticals with improved efficacy and selectivity.