
Catalog Number	AR00IBV9
Chemical Name	(2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,10R,12R,14R,17S)-3,12-dihydroxy-17-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
CAS Number	63223-86-9
Molecular Formula	C36H62O9
Molecular Weight	638.8721
MDL Number	MFCD09951797
SMILES	OC[C@H]1O[C@@H](O[C@H]2C[C@]3(C)[C@@H]([C@@]4([C@@H]2C(C)(C)[C@@H](O)CC4)C)C[C@H]([C@H]2[C@@]3(C)CC[C@@H]2[C@](CCC=C(C)C)(O)C)O)[C@@H]([C@H]([C@@H]1O)O)O

Ginsenoside Rh1, a bioactive component derived from Panax ginseng, plays a crucial role in chemical synthesis, particularly in the field of drug development and medicinal chemistry. Known for its diverse pharmacological properties, Ginsenoside Rh1 has been extensively studied for its potential therapeutic applications.In chemical synthesis, Ginsenoside Rh1 serves as a valuable starting material or intermediate for the construction of novel molecules with pharmacological activities. Its unique chemical structure containing multiple functional groups provides opportunities for functionalization and modification, allowing chemists to design and synthesize compounds with enhanced biological properties.One key application of Ginsenoside Rh1 in chemical synthesis is its use as a building block for the creation of semi-synthetic analogs with improved bioavailability, potency, and selectivity. By strategically modifying the structure of Ginsenoside Rh1, researchers can optimize its pharmacokinetic profile and target specific biological pathways, making it a promising candidate for drug discovery and development.Furthermore, Ginsenoside Rh1 can also serve as a versatile chiral building block in asymmetric synthesis, enabling the creation of enantiomerically pure compounds with high stereochemical control. Its chiral nature makes it a valuable tool for the production of pharmaceuticals, agrochemicals, and other complex molecules requiring precise stereochemistry.Overall, the application of Ginsenoside Rh1 in chemical synthesis showcases its potential as a versatile and valuable resource for the creation of novel bioactive compounds with diverse applications in medicinal chemistry and drug design.