
Catalog Number	AR00EDJJ
Chemical Name	CBZ-D-PHENYLALANINAL
CAS Number	63219-70-5
Molecular Formula	C17H17NO3
Molecular Weight	283.3218
MDL Number	MFCD01317841
SMILES	O=C[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1

The (R)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate is a versatile chemical reagent widely utilized in chemical synthesis processes. This compound serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structural features and reactivity. In synthetic organic chemistry, (R)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate is commonly employed as a key intermediate in the synthesis of complex molecules, particularly those with pharmaceutical relevance. Its functionality allows for the introduction of diverse chemical groups and stereochemical control, enabling chemists to tailor the properties of the final products. The application of (R)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate in chemical synthesis is integral to the development of novel compounds with potential therapeutic benefits and other valuable applications in the field of chemistry.