
Catalog Number	AR00J1PJ
Chemical Name	4-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid
CAS Number	63165-02-6
Molecular Formula	C12H12O3
Molecular Weight	204.2219
MDL Number	MFCD00168835
SMILES	OC(=O)c1ccc(cc1)C#CC(O)(C)C

4-(3-Hydroxy-3-methyl-1-butyn-1-yl)benzoic acid is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. In organic chemistry, this compound serves as a key building block for the synthesis of various pharmaceuticals, agrochemicals, and advanced materials.One of the primary applications of 4-(3-Hydroxy-3-methyl-1-butyn-1-yl)benzoic acid is in the synthesis of novel drug candidates. By incorporating this compound into the molecular structure of pharmaceuticals, chemists can modulate the biological activity and pharmacokinetic properties of the resulting drug molecules. Additionally, the presence of the alkyne moiety in the compound enables further functionalization through click chemistry reactions, allowing for the attachment of specific targeting ligands or imaging agents for drug delivery applications.Furthermore, 4-(3-Hydroxy-3-methyl-1-butyn-1-yl)benzoic acid can be utilized in the construction of complex natural product derivatives. Its unique structural features make it a valuable precursor for the synthesis of bioactive compounds found in nature, providing chemists with the tools to explore new chemical space and develop potential therapeutics or agrochemicals.Overall, the application of 4-(3-Hydroxy-3-methyl-1-butyn-1-yl)benzoic acid in chemical synthesis offers a wide range of possibilities for creating novel molecules with tailored properties and applications in the fields of medicine, agriculture, and materials science.