
Catalog Number	AR00F6FK
Chemical Name	methyl 2,3-dichloro-5-nitrobenzoate
CAS Number	63105-54-4
Molecular Formula	C8H5Cl2NO4
Molecular Weight	250.0356
MDL Number	MFCD12172998
SMILES	COC(=O)c1cc(cc(c1Cl)Cl)[N+](=O)[O-]

Methyl 2,3-dichloro-5-nitrobenzoate is a versatile compound frequently employed in chemical synthesis as a key building block. Due to its unique structure, this compound serves as a valuable intermediate in the creation of various complex molecules. Its presence is critical in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals, where its functional groups play a crucial role in facilitating desired chemical transformations. By incorporating Methyl 2,3-dichloro-5-nitrobenzoate into reactions, chemists can achieve precise control over the synthesis of target compounds, ultimately leading to the production of high-quality and pure substances with specific applications in industry and research.