
Catalog Number	AR00F6FJ
Chemical Name	methyl 3,4-dichloro-5-nitrobenzoate
CAS Number	63105-53-3
Molecular Formula	C8H5Cl2NO4
Molecular Weight	250.0356
MDL Number	MFCD12172531
SMILES	COC(=O)c1cc(Cl)c(c(c1)[N+](=O)[O-])Cl

Methyl 3,4-dichloro-5-nitrobenzoate is a versatile compound commonly utilized in chemical synthesis for the preparation of various organic molecules. This compound serves as a valuable building block in the creation of pharmaceuticals, agrochemicals, and materials due to its unique reactivity and functional group compatibility. In particular, Methyl 3,4-dichloro-5-nitrobenzoate is frequently employed in the synthesis of complex heterocyclic compounds, such as benzimidazoles, quinazolines, and benzothiophenes, which exhibit diverse biological activities and industrial applications. Additionally, its presence in the chemical toolbox enables the efficient introduction of nitro, chloro, and ester functionalities into target molecules, facilitating the generation of structurally diverse compounds with tailored properties.