
Catalog Number	AR00EA71
Chemical Name	H-ASN-OTBU
CAS Number	63094-81-5
Molecular Formula	C8H16N2O3
Molecular Weight	188.2242
MDL Number	MFCD00039079
SMILES	N[C@H](C(=O)OC(C)(C)C)CC(=O)N

The H-Asn-OtBu HCl compound plays a pivotal role in chemical synthesis as a versatile reagent. Known for its ability to selectively protect amino groups, this compound is commonly used to facilitate peptide synthesis by blocking reactive functionalities. Its application extends to the protection of amino acid side chains during various organic reactions, allowing for precise control over the synthesis of complex molecules. Furthermore, H-Asn-OtBu HCl serves as a valuable tool in the modification and functionalization of peptides and proteins in the field of bioconjugation chemistry. Its compatibility with a wide range of substrates and mild reaction conditions make it a preferred choice for researchers and chemists working in the synthesis of peptides and related compounds.