
Catalog Number	AR00EEA5
Chemical Name	H-GLU(OBZL)-NH2 HCL
CAS Number	63091-89-4
Molecular Formula	C12H17ClN2O3
Molecular Weight	272.728
MDL Number	MFCD00153434
SMILES	O=C(OCc1ccccc1)CC[C@@H](C(=O)N)N.Cl

(S)-Benzyl 4,5-diamino-5-oxopentanoate hydrochloride, a key compound in chemical synthesis, is a versatile reagent utilized in various reactions to form complex organic molecules. This compound acts as a valuable building block in the creation of pharmaceuticals, agrochemicals, and materials with specific properties. Its chiral nature enables precise control over the stereochemistry of the synthesized products, making it a crucial component in asymmetric synthesis. By employing (S)-Benzyl 4,5-diamino-5-oxopentanoate hydrochloride, chemists can efficiently access a wide range of enantiomerically pure compounds, expanding the possibilities in drug discovery, materials science, and chemical research.