
Catalog Number	AR00ELXP
Chemical Name	L-Histidine, 1-(2,4-dinitrophenyl)-N-[(phenylMethoxy)carbonyl]-
CAS Number	63013-46-7
Molecular Formula	C20H17N5O8
Molecular Weight	455.3776799999999
MDL Number	MFCD20264817
SMILES	O=C(N[C@H](C(=O)O)Cc1ncn(c1)c1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])OCc1ccccc1

The (S)-2-(((Benzyloxy)carbonyl)amino)-3-(1-(2,4-dinitrophenyl)-1H-imidazol-4-yl)propanoic acid, often referred to as $name$, plays a crucial role in chemical synthesis as a versatile building block in the creation of complex organic molecules. This compound is particularly valuable in peptide synthesis and drug development due to its ability to serve as a precursor for the formation of peptide bonds. By incorporating (S)-2-(((Benzyloxy)carbonyl)amino)-3-(1-(2,4-dinitrophenyl)-1H-imidazol-4-yl)propanoic acid into reaction sequences, chemists can manipulate the structure and properties of the resulting molecules, allowing for the synthesis of new bioactive compounds and materials with tailored functions.