
Catalog Number	AR00EX38
Chemical Name	1H-Benzimidazole-2-ethanamine,5-methyl-(9CI)
CAS Number	630091-54-2
Molecular Formula	C10H15Cl2N3
Molecular Weight	248.1522
MDL Number	MFCD06312156
SMILES	NCCc1nc2c([nH]1)ccc(c2)C.Cl.Cl

6-Methyl-1H-benzimidazole-2-ethanamine, also known as $name$, is a versatile compound commonly used in chemical synthesis. With its unique structure and functional groups, this compound plays a crucial role in a variety of synthetic pathways. One of the key applications of 6-Methyl-1H-benzimidazole-2-ethanamine in chemical synthesis is as a building block for the synthesis of complex organic molecules. Its amino group can serve as a reactive site for further derivatization, allowing for the introduction of various functional groups. This compound can be utilized in the preparation of pharmaceutical intermediates, agrochemicals, and organic materials.Additionally, 6-Methyl-1H-benzimidazole-2-ethanamine can be employed as a ligand in coordination chemistry, where it can form coordination complexes with transition metals. These complexes can exhibit unique reactivity and catalytic properties, making them valuable in various chemical transformations.Overall, the versatility of 6-Methyl-1H-benzimidazole-2-ethanamine in chemical synthesis makes it a valuable tool for organic chemists and researchers looking to access diverse chemical structures and novel compounds.