
Catalog Number	AR00EGGH
Chemical Name	2-AMINO-5-METHYL-3,7-DIHYDRO-4H-PYRROLO[2,3-D]PYRIMIDIN-4-ONE
CAS Number	62981-82-2
Molecular Formula	C7H8N4O
Molecular Weight	164.1646
MDL Number	MFCD09038076
SMILES	Cc1[nH]c2c(c1)c(=O)[nH]c(=N)[nH]2

2-Amino-3,7-dihydro-6-methyl-4H-pyrrolo[2,3-d]pyrimidin-4-one is a versatile compound widely used in chemical synthesis. This compound plays a crucial role in the production of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties and reactivity. In chemical synthesis, the application of 2-Amino-3,7-dihydro-6-methyl-4H-pyrrolo[2,3-d]pyrimidin-4-one serves as a key building block in the creation of heterocyclic compounds. Its functional groups and molecular structure allow for diverse synthetic pathways, making it an essential intermediate in the development of novel chemical entities. Furthermore, this compound is utilized in the synthesis of biologically active molecules such as antiviral agents, antitumor drugs, and enzyme inhibitors. Its presence in these compounds imparts specific pharmacological activities and enhances their efficacy.Overall, 2-Amino-3,7-dihydro-6-methyl-4H-pyrrolo[2,3-d]pyrimidin-4-one plays a crucial role in chemical synthesis by enabling the construction of complex structures and facilitating the development of valuable compounds with diverse applications.