
Catalog Number	AR00EIVC
Chemical Name	5,7-Dihydroxy-2-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl)-3-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one
CAS Number	62949-77-3
Molecular Formula	C25H24O6
Molecular Weight	420.4545
MDL Number	MFCD31382182
SMILES	CC(=CCc1c(oc2c(c1=O)c(O)cc(c2)O)c1ccc(c2c1OC(C)(C)C=C2)O)C

The compound 5,7-Dihydroxy-2-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl)-3-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing multiple hydroxyl groups and aromatic rings makes it a valuable reagent for various synthetic pathways.In chemical synthesis, $name$ can be utilized as a key intermediate in the production of complex natural products and pharmaceutical compounds. The hydroxyl groups present in $name$ can participate in a range of chemical reactions, such as esterifications, etherifications, and oxidative transformations, allowing for the introduction of diverse functional groups.Furthermore, the conjugated double bonds in the structure of $name$ make it a useful substrate for Diels-Alder reactions, which can be employed to construct intricate ring systems found in many biologically active molecules. Overall, the strategic incorporation of $name$ in synthetic routes offers chemists the opportunity to access structurally diverse compounds with potential pharmacological or biological activities.