
Catalog Number	AR00ELDS
Chemical Name	4-(3-Methoxycarbonylphenyl)-2-Methylphenol
CAS Number	627906-50-7
Molecular Formula	C15H14O3
Molecular Weight	242.2699
MDL Number	MFCD18313319
SMILES	COC(=O)c1cccc(c1)c1ccc(c(c1)C)O

4-(3-Methoxycarbonylphenyl)-2-Methylphenol, also known by its chemical structure, is a versatile compound widely utilized in chemical synthesis processes. One of the key applications of this compound lies in its role as a valuable building block for the synthesis of biologically active molecules. In chemical synthesis, 4-(3-Methoxycarbonylphenyl)-2-Methylphenol serves as a crucial intermediate in the construction of complex organic compounds due to its unique structural properties. This compound can undergo various chemical reactions, such as acylation, alkylation, and condensation reactions, to form new compounds with enhanced properties and functionalities.Moreover, the presence of both a methoxycarbonyl group and a methyl group in its structure imparts specific reactivity and selectivity to 4-(3-Methoxycarbonylphenyl)-2-Methylphenol, making it a valuable tool for chemists in designing and synthesizing novel compounds. Its versatility and reactivity make it an indispensable component in the toolbox of synthetic chemists working on the development of pharmaceuticals, agrochemicals, and materials science.